About CID 59694749
CID 59694749 (PubChem CID 59694749) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol.
Molecular Properties
| Compound Name | CID 59694749 |
| PubChem CID | 59694749 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | — |
| SMILES | [CH]CNC(C)C(C)C |
| InChI | InChI=1S/C7H15N/c1-5-8-7(4)6(2)3/h1,6-8H,5H2,2-4H3 |
| InChIKey | GIVMDGWTCKVMIH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59694749 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59694749?
The IUPAC name of CID 59694749 (CID 59694749) is not available.
What is the SMILES notation for CID 59694749?
The canonical SMILES for CID 59694749 is [CH]CNC(C)C(C)C.
What is the InChIKey of CID 59694749?
The InChIKey is GIVMDGWTCKVMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N/c1-5-8-7(4)6(2)3/h1,6-8H,5H2,2-4H3.
What are the key properties of CID 59694749?
CID 59694749 has a molecular weight of 113.20 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59694749 is sourced from PubChem (CID 59694749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).