About CID 59694785
CID 59694785 (PubChem CID 59694785) has the molecular formula C6H12NO
and a molecular weight of 114.17 g/mol.
Molecular Properties
| Compound Name | CID 59694785 |
| PubChem CID | 59694785 |
| Molecular Formula | C6H12NO |
| Molecular Weight | 114.17 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H]1CO[CH]N1 |
| InChI | InChI=1S/C6H12NO/c1-5(2)6-3-8-4-7-6/h4-7H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | TWXBMRFPHQPGOZ-ZCFIWIBFSA-N |
| XLogP | 0.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59694785 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59694785?
The IUPAC name of CID 59694785 (CID 59694785) is not available.
What is the SMILES notation for CID 59694785?
The canonical SMILES for CID 59694785 is CC(C)[C@H]1CO[CH]N1.
What is the InChIKey of CID 59694785?
The InChIKey is TWXBMRFPHQPGOZ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H12NO/c1-5(2)6-3-8-4-7-6/h4-7H,3H2,1-2H3/t6-/m1/s1.
What are the key properties of CID 59694785?
CID 59694785 has a molecular weight of 114.17 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59694785 is sourced from PubChem (CID 59694785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).