C56H44Cl2N4O4P2Pt+2 — CID 59695537
dichloroplatinum;bis((1S,3S)-1,2,3-triphenyl-2,3-dihydro-1H-[1,2,4]diazaphospholo[1,2-b]phthalazin-2-ium-5,10-dione) (PubChem CID 59695537) has the molecular formula C56H44Cl2N4O4P2Pt+2 and a molecular weight of 1164.92 g/mol. Its IUPAC name is dichloroplatinum;bis((1S,3S)-1,2,3-triphenyl-2,3-dihydro-1H-[1,2,4]diazaphospholo[1,2-b]phthalazin-2-ium-5,10-dione).
| Compound Name | dichloroplatinum;bis((1S,3S)-1,2,3-triphenyl-2,3-dihydro-1H-[1,2,4]diazaphospholo[1,2-b]phthalazin-2-ium-5,10-dione) |
|---|---|
| PubChem CID | 59695537 |
| Molecular Formula | C56H44Cl2N4O4P2Pt+2 |
| Molecular Weight | 1164.92 g/mol |
| Exact Mass | 1163.19 |
| IUPAC Name | dichloroplatinum;bis((1S,3S)-1,2,3-triphenyl-2,3-dihydro-1H-[1,2,4]diazaphospholo[1,2-b]phthalazin-2-ium-5,10-dione) |
| SMILES | Cl[Pt]Cl.O=c1c2ccccc2c(=O)n2n1[C@H](c1ccccc1)[PH+](c1ccccc1)[C@H]2c1ccccc1.O=c1c2ccccc2c(=O)n2n1[C@H](c1ccccc1)[PH+](c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/2C28H21N2O2P.2ClH.Pt/c2*31-25-23-18-10-11-19-24(23)26(32)30-28(21-14-6-2-7-15-21)33(22-16-8-3-9-17-22)27(29(25)30)20-12-4-1-5-13-20;;;/h2*1-19,27-28H;2*1H;/q;;;;+2/t2*27-,28-;;;/m00.../s1 |
| InChIKey | PJTOEGRPBGVPKR-HTFQGUBTSA-N |
| XLogP | 11.00 |
| TPSA | 88.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.92 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|