About 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine
2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine (PubChem CID 59695647) has the molecular formula C30H18N2O4
and a molecular weight of 470.48 g/mol. Its IUPAC name is 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine.
Molecular Properties
| Compound Name | 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine |
| PubChem CID | 59695647 |
| Molecular Formula | C30H18N2O4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine |
| SMILES | c1ccc2c(c1)c1ccccc1c1nc(-c3ccc4c(c3)OCO4)c(-c3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C30H18N2O4/c1-3-7-21-19(5-1)20-6-2-4-8-22(20)30-29(21)31-27(17-9-11-23-25(13-17)35-15-33-23)28(32-30)18-10-12-24-26(14-18)36-16-34-24/h1-14H,15-16H2 |
| InChIKey | NBOWCQWVPASNOM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine?
The IUPAC name of 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine (CID 59695647) is 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine.
What is the SMILES notation for 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine?
The canonical SMILES for 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine is c1ccc2c(c1)c1ccccc1c1nc(-c3ccc4c(c3)OCO4)c(-c3ccc4c(c3)OCO4)nc21.
What is the InChIKey of 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine?
The InChIKey is NBOWCQWVPASNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18N2O4/c1-3-7-21-19(5-1)20-6-2-4-8-22(20)30-29(21)31-27(17-9-11-23-25(13-17)35-15-33-23)28(32-30)18-10-12-24-26(14-18)36-16-34-24/h1-14H,15-16H2.
What are the key properties of 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine?
2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine has a molecular weight of 470.48 g/mol, XLogP of 6.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(1,3-benzodioxol-5-yl)phenanthro[9,10-b]pyrazine is sourced from PubChem (CID 59695647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).