C31H30O4 — CID 59695892
1-[4-[[4-(6-pentoxynaphthalen-2-yl)phenoxy]methoxy]phenyl]prop-2-en-1-one (PubChem CID 59695892) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[4-[[4-(6-pentoxynaphthalen-2-yl)phenoxy]methoxy]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-(6-pentoxynaphthalen-2-yl)phenoxy]methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59695892 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1-[4-[[4-(6-pentoxynaphthalen-2-yl)phenoxy]methoxy]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(OCOc2ccc(-c3ccc4cc(OCCCCC)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C31H30O4/c1-3-5-6-19-33-30-18-13-26-20-25(7-8-27(26)21-30)23-9-14-28(15-10-23)34-22-35-29-16-11-24(12-17-29)31(32)4-2/h4,7-18,20-21H,2-3,5-6,19,22H2,1H3 |
| InChIKey | DYBADRFIRKCKGR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|