C10H21N2O4+ — CID 59696095
N,1-bis(2-hydroxyethyl)-1-methoxypyrrolidin-1-ium-2-carboxamide (PubChem CID 59696095) has the molecular formula C10H21N2O4+ and a molecular weight of 233.29 g/mol. Its IUPAC name is N,1-bis(2-hydroxyethyl)-1-methoxypyrrolidin-1-ium-2-carboxamide.
| Compound Name | N,1-bis(2-hydroxyethyl)-1-methoxypyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 59696095 |
| Molecular Formula | C10H21N2O4+ |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N,1-bis(2-hydroxyethyl)-1-methoxypyrrolidin-1-ium-2-carboxamide |
| SMILES | CO[N+]1(CCO)CCCC1C(=O)NCCO |
| InChI | InChI=1S/C10H20N2O4/c1-16-12(6-8-14)5-2-3-9(12)10(15)11-4-7-13/h9,13-14H,2-8H2,1H3/p+1 |
| InChIKey | FNRJXZUMEZCCQV-UHFFFAOYSA-O |
| XLogP | -1.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|