About 5,7-dichloro-3-methylimidazo[4,5-b]pyridine
5,7-dichloro-3-methylimidazo[4,5-b]pyridine (PubChem CID 59696154) has the molecular formula C7H5Cl2N3
and a molecular weight of 202.04 g/mol. Its IUPAC name is 5,7-dichloro-3-methylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5,7-dichloro-3-methylimidazo[4,5-b]pyridine |
| PubChem CID | 59696154 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 5,7-dichloro-3-methylimidazo[4,5-b]pyridine |
| SMILES | Cn1cnc2c(Cl)cc(Cl)nc21 |
| InChI | InChI=1S/C7H5Cl2N3/c1-12-3-10-6-4(8)2-5(9)11-7(6)12/h2-3H,1H3 |
| InChIKey | OHNMKUCBLXFYMW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-methylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-methylimidazo[4,5-b]pyridine?
The IUPAC name of 5,7-dichloro-3-methylimidazo[4,5-b]pyridine (CID 59696154) is 5,7-dichloro-3-methylimidazo[4,5-b]pyridine.
What is the SMILES notation for 5,7-dichloro-3-methylimidazo[4,5-b]pyridine?
The canonical SMILES for 5,7-dichloro-3-methylimidazo[4,5-b]pyridine is Cn1cnc2c(Cl)cc(Cl)nc21.
What is the InChIKey of 5,7-dichloro-3-methylimidazo[4,5-b]pyridine?
The InChIKey is OHNMKUCBLXFYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3/c1-12-3-10-6-4(8)2-5(9)11-7(6)12/h2-3H,1H3.
What are the key properties of 5,7-dichloro-3-methylimidazo[4,5-b]pyridine?
5,7-dichloro-3-methylimidazo[4,5-b]pyridine has a molecular weight of 202.04 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-methylimidazo[4,5-b]pyridine is sourced from PubChem (CID 59696154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).