C17H21N2O4Y- — CID 59696824
(2S)-1-[(2S)-2-[(2,5-dimethylbenzene-4-ide-1-carbonyl)amino]propanoyl]pyrrolidine-2-carboxylic acid;yttrium (PubChem CID 59696824) has the molecular formula C17H21N2O4Y- and a molecular weight of 406.27 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(2,5-dimethylbenzene-4-ide-1-carbonyl)amino]propanoyl]pyrrolidine-2-carboxylic acid;yttrium.
| Compound Name | (2S)-1-[(2S)-2-[(2,5-dimethylbenzene-4-ide-1-carbonyl)amino]propanoyl]pyrrolidine-2-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 59696824 |
| Molecular Formula | C17H21N2O4Y- |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (2S)-1-[(2S)-2-[(2,5-dimethylbenzene-4-ide-1-carbonyl)amino]propanoyl]pyrrolidine-2-carboxylic acid;yttrium |
| SMILES | Cc1[c-]cc(C)c(C(=O)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O)c1.[Y] |
| InChI | InChI=1S/C17H21N2O4.Y/c1-10-6-7-11(2)13(9-10)15(20)18-12(3)16(21)19-8-4-5-14(19)17(22)23;/h7,9,12,14H,4-5,8H2,1-3H3,(H,18,20)(H,22,23);/q-1;/t12-,14-;/m0./s1 |
| InChIKey | NVCCDKMBXUPNFJ-KYSPHBLOSA-N |
| XLogP | 1.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|