C28H24FN5O4 — CID 59697217
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-(2-fluoroanilino)acetyl]amino]phenyl]buta-1,3-diynyl]benzamide (PubChem CID 59697217) has the molecular formula C28H24FN5O4 and a molecular weight of 513.53 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-(2-fluoroanilino)acetyl]amino]phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-(2-fluoroanilino)acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59697217 |
| Molecular Formula | C28H24FN5O4 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-(2-fluoroanilino)acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNc3ccccc3F)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C28H24FN5O4/c29-23-7-3-4-8-24(23)31-18-26(35)32-22-15-11-20(12-16-22)6-2-1-5-19-9-13-21(14-10-19)27(36)33-25(17-30)28(37)34-38/h3-4,7-16,25,31,38H,17-18,30H2,(H,32,35)(H,33,36)(H,34,37)/t25-/m0/s1 |
| InChIKey | WVZQVQOCTGWWKI-VWLOTQADSA-N |
| XLogP | 1.84 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|