C24H27N5O5 — CID 59697828
(2S,3R)-N,3-dihydroxy-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[2-(4-phenylphenyl)acetyl]amino]propanoyl]amino]butanamide (PubChem CID 59697828) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[2-(4-phenylphenyl)acetyl]amino]propanoyl]amino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[2-(4-phenylphenyl)acetyl]amino]propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 59697828 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[[2-(4-phenylphenyl)acetyl]amino]propanoyl]amino]butanamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H27N5O5/c1-15(30)22(24(33)29-34)28-23(32)20(12-19-13-25-14-26-19)27-21(31)11-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h2-10,13-15,20,22,30,34H,11-12H2,1H3,(H,25,26)(H,27,31)(H,28,32)(H,29,33)/t15-,20+,22+/m1/s1 |
| InChIKey | RWGONMYRYXRRKM-PDXHDDNESA-N |
| XLogP | 0.72 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|