C22H13F2NO — CID 59698409
4-[4-[2-(2,6-difluoro-4-methoxyphenyl)ethynyl]phenyl]benzonitrile (PubChem CID 59698409) has the molecular formula C22H13F2NO and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-[4-[2-(2,6-difluoro-4-methoxyphenyl)ethynyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(2,6-difluoro-4-methoxyphenyl)ethynyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 59698409 |
| Molecular Formula | C22H13F2NO |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[4-[2-(2,6-difluoro-4-methoxyphenyl)ethynyl]phenyl]benzonitrile |
| SMILES | COc1cc(F)c(C#Cc2ccc(-c3ccc(C#N)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C22H13F2NO/c1-26-19-12-21(23)20(22(24)13-19)11-6-15-2-7-17(8-3-15)18-9-4-16(14-25)5-10-18/h2-5,7-10,12-13H,1H3 |
| InChIKey | KNXVQMRBHJENMG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|