About 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one
4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one (PubChem CID 596985) has the molecular formula C18H18O2S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one.
Molecular Properties
| Compound Name | 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one |
| PubChem CID | 596985 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one |
| SMILES | CCCC1OC(=O)C(c2ccccc2)(c2ccccc2)S1 |
| InChI | InChI=1S/C18H18O2S/c1-2-9-16-20-17(19)18(21-16,14-10-5-3-6-11-14)15-12-7-4-8-13-15/h3-8,10-13,16H,2,9H2,1H3 |
| InChIKey | MDLIGFFCJHLROW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one?
The IUPAC name of 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one (CID 596985) is 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one.
What is the SMILES notation for 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one?
The canonical SMILES for 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one is CCCC1OC(=O)C(c2ccccc2)(c2ccccc2)S1.
What is the InChIKey of 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one?
The InChIKey is MDLIGFFCJHLROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2S/c1-2-9-16-20-17(19)18(21-16,14-10-5-3-6-11-14)15-12-7-4-8-13-15/h3-8,10-13,16H,2,9H2,1H3.
What are the key properties of 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one?
4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one has a molecular weight of 298.41 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenyl-2-propyl-1,3-oxathiolan-5-one is sourced from PubChem (CID 596985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).