About 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium
5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium (PubChem CID 59698765) has the molecular formula C8H12NY-
and a molecular weight of 211.10 g/mol. Its IUPAC name is 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium.
Molecular Properties
| Compound Name | 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium |
| PubChem CID | 59698765 |
| Molecular Formula | C8H12NY- |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium |
| SMILES | CC(C)(C)c1cc[c-][nH]1.[Y] |
| InChI | InChI=1S/C8H12N.Y/c1-8(2,3)7-5-4-6-9-7;/h4-5,9H,1-3H3;/q-1; |
| InChIKey | CMRDZUBZTYSFND-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium?
The IUPAC name of 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium (CID 59698765) is 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium.
What is the SMILES notation for 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium?
The canonical SMILES for 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium is CC(C)(C)c1cc[c-][nH]1.[Y].
What is the InChIKey of 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium?
The InChIKey is CMRDZUBZTYSFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.Y/c1-8(2,3)7-5-4-6-9-7;/h4-5,9H,1-3H3;/q-1;.
What are the key properties of 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium?
5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium has a molecular weight of 211.10 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,2-dihydropyrrol-2-ide;yttrium is sourced from PubChem (CID 59698765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).