C17H13F3N2OS — CID 59698808
2-[2-ethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl]acetaldehyde (PubChem CID 59698808) has the molecular formula C17H13F3N2OS and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[2-ethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl]acetaldehyde.
| Compound Name | 2-[2-ethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl]acetaldehyde |
|---|---|
| PubChem CID | 59698808 |
| Molecular Formula | C17H13F3N2OS |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[2-ethyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl]acetaldehyde |
| SMILES | CCc1ncc(Cc2nc3c(F)c(F)cc(F)c3s2)cc1CC=O |
| InChI | InChI=1S/C17H13F3N2OS/c1-2-13-10(3-4-23)5-9(8-21-13)6-14-22-16-15(20)11(18)7-12(19)17(16)24-14/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | BQVMMUKBVAZJDK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|