About 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile
4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile (PubChem CID 59699230) has the molecular formula C34H43N5O3
and a molecular weight of 569.75 g/mol. Its IUPAC name is 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile |
| PubChem CID | 59699230 |
| Molecular Formula | C34H43N5O3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile |
| SMILES | CCN(CC)CCCOc1cc(OCCCN(CC)CC)c2nc(-c3cccc(Oc4ccc(C#N)cc4)c3)[nH]c2c1 |
| InChI | InChI=1S/C34H43N5O3/c1-5-38(6-2)18-10-20-40-30-23-31-33(32(24-30)41-21-11-19-39(7-3)8-4)37-34(36-31)27-12-9-13-29(22-27)42-28-16-14-26(25-35)15-17-28/h9,12-17,22-24H,5-8,10-11,18-21H2,1-4H3,(H,36,37) |
| InChIKey | JELZGLNEFYPTJY-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile?
The IUPAC name of 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile (CID 59699230) is 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile.
What is the SMILES notation for 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile?
The canonical SMILES for 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile is CCN(CC)CCCOc1cc(OCCCN(CC)CC)c2nc(-c3cccc(Oc4ccc(C#N)cc4)c3)[nH]c2c1.
What is the InChIKey of 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile?
The InChIKey is JELZGLNEFYPTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H43N5O3/c1-5-38(6-2)18-10-20-40-30-23-31-33(32(24-30)41-21-11-19-39(7-3)8-4)37-34(36-31)27-12-9-13-29(22-27)42-28-16-14-26(25-35)15-17-28/h9,12-17,22-24H,5-8,10-11,18-21H2,1-4H3,(H,36,37).
What are the key properties of 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile?
4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile has a molecular weight of 569.75 g/mol, XLogP of 7.12, 17 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4,6-bis[3-(diethylamino)propoxy]-1H-benzimidazol-2-yl]phenoxy]benzonitrile is sourced from PubChem (CID 59699230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).