About 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid
4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid (PubChem CID 596995) has the molecular formula C15H10N2O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid |
| PubChem CID | 596995 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H10N2O3/c18-15(19)12-8-6-11(7-9-12)14-17-16-13(20-14)10-4-2-1-3-5-10/h1-9H,(H,18,19) |
| InChIKey | KJSLGQIRTJNTKD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The IUPAC name of 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid (CID 596995) is 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid.
What is the SMILES notation for 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The canonical SMILES for 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid is O=C(O)c1ccc(-c2nnc(-c3ccccc3)o2)cc1.
What is the InChIKey of 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The InChIKey is KJSLGQIRTJNTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3/c18-15(19)12-8-6-11(7-9-12)14-17-16-13(20-14)10-4-2-1-3-5-10/h1-9H,(H,18,19).
What are the key properties of 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid?
4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid has a molecular weight of 266.26 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzoic acid is sourced from PubChem (CID 596995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).