About 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine
3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59699705) has the molecular formula C18H11F2N3
and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 59699705 |
| Molecular Formula | C18H11F2N3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1cccc(-c2c[nH]c3ncc(-c4ccncc4)cc23)c1F |
| InChI | InChI=1S/C18H11F2N3/c19-16-3-1-2-13(17(16)20)15-10-23-18-14(15)8-12(9-22-18)11-4-6-21-7-5-11/h1-10H,(H,22,23) |
| InChIKey | VEOUNFWEPXSYLO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine (CID 59699705) is 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine is Fc1cccc(-c2c[nH]c3ncc(-c4ccncc4)cc23)c1F.
What is the InChIKey of 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is VEOUNFWEPXSYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F2N3/c19-16-3-1-2-13(17(16)20)15-10-23-18-14(15)8-12(9-22-18)11-4-6-21-7-5-11/h1-10H,(H,22,23).
What are the key properties of 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine?
3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 307.30 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-5-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 59699705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).