C26H25BF2N2O4S — CID 59699713
3-(2,3-difluorophenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 59699713) has the molecular formula C26H25BF2N2O4S and a molecular weight of 510.37 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,3-difluorophenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59699713 |
| Molecular Formula | C26H25BF2N2O4S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3cccc(F)c3F)c3cc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C26H25BF2N2O4S/c1-16-9-11-18(12-10-16)36(32,33)31-15-21(19-7-6-8-22(28)23(19)29)20-13-17(14-30-24(20)31)27-34-25(2,3)26(4,5)35-27/h6-15H,1-5H3 |
| InChIKey | XJZAULQLJSOJQU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|