C20H17N4O3+ — CID 59699717
1-hydroxy-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]pyridin-1-ium-3-carboxamide (PubChem CID 59699717) has the molecular formula C20H17N4O3+ and a molecular weight of 361.38 g/mol. Its IUPAC name is 1-hydroxy-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-hydroxy-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 59699717 |
| Molecular Formula | C20H17N4O3+ |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-hydroxy-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]pyridin-1-ium-3-carboxamide |
| SMILES | COc1ccccc1-c1c[nH]c2ncc(-c3cc(C(N)=O)c[n+](O)c3)cc12 |
| InChI | InChI=1S/C20H16N4O3/c1-27-18-5-3-2-4-15(18)17-9-23-20-16(17)7-12(8-22-20)13-6-14(19(21)25)11-24(26)10-13/h2-11H,1H3,(H3-,21,22,23,25,26)/p+1 |
| InChIKey | ZVDCNLKVEYSNHE-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|