About N,2,2-triphenylethenimine
N,2,2-triphenylethenimine (PubChem CID 596998) has the molecular formula C20H15N
and a molecular weight of 269.35 g/mol. Its IUPAC name is N,2,2-triphenylethenimine.
Molecular Properties
| Compound Name | N,2,2-triphenylethenimine |
| PubChem CID | 596998 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N,2,2-triphenylethenimine |
| SMILES | C(=Nc1ccccc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15N/c1-4-10-17(11-5-1)20(18-12-6-2-7-13-18)16-21-19-14-8-3-9-15-19/h1-15H |
| InChIKey | VQOIZBIQANZRDY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2,2-triphenylethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,2-triphenylethenimine?
The IUPAC name of N,2,2-triphenylethenimine (CID 596998) is N,2,2-triphenylethenimine.
What is the SMILES notation for N,2,2-triphenylethenimine?
The canonical SMILES for N,2,2-triphenylethenimine is C(=Nc1ccccc1)=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N,2,2-triphenylethenimine?
The InChIKey is VQOIZBIQANZRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N/c1-4-10-17(11-5-1)20(18-12-6-2-7-13-18)16-21-19-14-8-3-9-15-19/h1-15H.
What are the key properties of N,2,2-triphenylethenimine?
N,2,2-triphenylethenimine has a molecular weight of 269.35 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,2-triphenylethenimine is sourced from PubChem (CID 596998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).