About 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol
3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (PubChem CID 59699823) has the molecular formula C20H16N2O
and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
Molecular Properties
| Compound Name | 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| PubChem CID | 59699823 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| SMILES | Cc1ccccc1-c1c[nH]c2ncc(-c3cccc(O)c3)cc12 |
| InChI | InChI=1S/C20H16N2O/c1-13-5-2-3-8-17(13)19-12-22-20-18(19)10-15(11-21-20)14-6-4-7-16(23)9-14/h2-12,23H,1H3,(H,21,22) |
| InChIKey | QZNMBTAISFUPAA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The IUPAC name of 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (CID 59699823) is 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
What is the SMILES notation for 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The canonical SMILES for 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol is Cc1ccccc1-c1c[nH]c2ncc(-c3cccc(O)c3)cc12.
What is the InChIKey of 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The InChIKey is QZNMBTAISFUPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O/c1-13-5-2-3-8-17(13)19-12-22-20-18(19)10-15(11-21-20)14-6-4-7-16(23)9-14/h2-12,23H,1H3,(H,21,22).
What are the key properties of 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol has a molecular weight of 300.36 g/mol, XLogP of 4.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol is sourced from PubChem (CID 59699823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).