C28H28BN3O4S — CID 59700011
3-(1H-indol-5-yl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 59700011) has the molecular formula C28H28BN3O4S and a molecular weight of 513.43 g/mol. Its IUPAC name is 3-(1H-indol-5-yl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(1H-indol-5-yl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59700011 |
| Molecular Formula | C28H28BN3O4S |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 3-(1H-indol-5-yl)-1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc4[nH]ccc4c3)c3cc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C28H28BN3O4S/c1-18-6-9-22(10-7-18)37(33,34)32-17-24(19-8-11-25-20(14-19)12-13-30-25)23-15-21(16-31-26(23)32)29-35-27(2,3)28(4,5)36-29/h6-17,30H,1-5H3 |
| InChIKey | QMXWBLWUJGQEFM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|