C23H19N3 — CID 59700061
3-(2-ethylphenyl)-5-(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59700061) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-5-(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2-ethylphenyl)-5-(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59700061 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-(2-ethylphenyl)-5-(1H-indol-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCc1ccccc1-c1c[nH]c2ncc(-c3ccc4[nH]ccc4c3)cc12 |
| InChI | InChI=1S/C23H19N3/c1-2-15-5-3-4-6-19(15)21-14-26-23-20(21)12-18(13-25-23)16-7-8-22-17(11-16)9-10-24-22/h3-14,24H,2H2,1H3,(H,25,26) |
| InChIKey | AUBVQXSKXNVBMU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |