C27H26BF3N2O5S — CID 59700087
1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[2-(trifluoromethoxy)phenyl]pyrrolo[2,3-b]pyridine (PubChem CID 59700087) has the molecular formula C27H26BF3N2O5S and a molecular weight of 558.39 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[2-(trifluoromethoxy)phenyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[2-(trifluoromethoxy)phenyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59700087 |
| Molecular Formula | C27H26BF3N2O5S |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[2-(trifluoromethoxy)phenyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccccc3OC(F)(F)F)c3cc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C27H26BF3N2O5S/c1-17-10-12-19(13-11-17)39(34,35)33-16-22(20-8-6-7-9-23(20)36-27(29,30)31)21-14-18(15-32-24(21)33)28-37-25(2,3)26(4,5)38-28/h6-16H,1-5H3 |
| InChIKey | LRSGRYBMEJDQRY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|