C24H22N4O3 — CID 59700179
2-formamido-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide (PubChem CID 59700179) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-formamido-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide.
| Compound Name | 2-formamido-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 59700179 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-formamido-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide |
| SMILES | COc1ccccc1-c1c[nH]c2ncc(-c3ccc(NC=O)c(C(=O)N(C)C)c3)cc12 |
| InChI | InChI=1S/C24H22N4O3/c1-28(2)24(30)19-10-15(8-9-21(19)27-14-29)16-11-18-20(13-26-23(18)25-12-16)17-6-4-5-7-22(17)31-3/h4-14H,1-3H3,(H,25,26)(H,27,29) |
| InChIKey | ZEUANUPSASCZFK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|