About 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten
6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten (PubChem CID 59700370) has the molecular formula C11H22FW-
and a molecular weight of 358.14 g/mol. Its IUPAC name is 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten.
Molecular Properties
| Compound Name | 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten |
| PubChem CID | 59700370 |
| Molecular Formula | C11H22FW- |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten |
| SMILES | [2H][C-](CC)CC(C)(C)CC(C)(C)F.[W] |
| InChI | InChI=1S/C11H22F.W/c1-6-7-8-10(2,3)9-11(4,5)12;/h7H,6,8-9H2,1-5H3;/q-1;/i7D; |
| InChIKey | MSZUIRNCFGMWAO-DRGWXPQLSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten?
The IUPAC name of 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten (CID 59700370) is 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten.
What is the SMILES notation for 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten?
The canonical SMILES for 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten is [2H][C-](CC)CC(C)(C)CC(C)(C)F.[W].
What is the InChIKey of 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten?
The InChIKey is MSZUIRNCFGMWAO-DRGWXPQLSA-N. The full InChI is InChI=1S/C11H22F.W/c1-6-7-8-10(2,3)9-11(4,5)12;/h7H,6,8-9H2,1-5H3;/q-1;/i7D;.
What are the key properties of 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten?
6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten has a molecular weight of 358.14 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-deuterio-2-fluoro-2,4,4-trimethyloctane;tungsten is sourced from PubChem (CID 59700370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).