C44H47F6NO6 — CID 59700540
3-methyl-1-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]-4-[2-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]propyl]pyrrolidine-2,5-dione (PubChem CID 59700540) has the molecular formula C44H47F6NO6 and a molecular weight of 799.85 g/mol. Its IUPAC name is 3-methyl-1-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]-4-[2-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]-4-[2-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59700540 |
| Molecular Formula | C44H47F6NO6 |
| Molecular Weight | 799.85 g/mol |
| Exact Mass | 799.33 |
| IUPAC Name | 3-methyl-1-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]-4-[2-[4-[6-(3,4,5-trifluorophenoxy)hexoxy]phenyl]propyl]pyrrolidine-2,5-dione |
| SMILES | CC(CC1C(=O)N(c2ccc(OCCCCCCOc3cc(F)c(F)c(F)c3)cc2)C(=O)C1C)c1ccc(OCCCCCCOc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C44H47F6NO6/c1-28(30-11-15-32(16-12-30)54-19-7-3-5-9-21-56-34-24-37(45)41(49)38(46)25-34)23-36-29(2)43(52)51(44(36)53)31-13-17-33(18-14-31)55-20-8-4-6-10-22-57-35-26-39(47)42(50)40(48)27-35/h11-18,24-29,36H,3-10,19-23H2,1-2H3 |
| InChIKey | KZYUALYMNWHFEW-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.85 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|