About 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride
4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride (PubChem CID 59700947) has the molecular formula C20H16ClN3O3S2
and a molecular weight of 445.95 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride |
| PubChem CID | 59700947 |
| Molecular Formula | C20H16ClN3O3S2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride |
| SMILES | [C-]#[N+]c1c(SC)nc(-c2ccc(S(=O)(=O)Cl)cc2)n(-c2ccc(C)c(C)c2)c1=O |
| InChI | InChI=1S/C20H16ClN3O3S2/c1-12-5-8-15(11-13(12)2)24-18(23-19(28-4)17(22-3)20(24)25)14-6-9-16(10-7-14)29(21,26)27/h5-11H,1-2,4H3 |
| InChIKey | AXNXLYUJQYSFNH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride?
The IUPAC name of 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride (CID 59700947) is 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride.
What is the SMILES notation for 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride?
The canonical SMILES for 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride is [C-]#[N+]c1c(SC)nc(-c2ccc(S(=O)(=O)Cl)cc2)n(-c2ccc(C)c(C)c2)c1=O.
What is the InChIKey of 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride?
The InChIKey is AXNXLYUJQYSFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O3S2/c1-12-5-8-15(11-13(12)2)24-18(23-19(28-4)17(22-3)20(24)25)14-6-9-16(10-7-14)29(21,26)27/h5-11H,1-2,4H3.
What are the key properties of 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride?
4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride has a molecular weight of 445.95 g/mol, XLogP of 4.72, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dimethylphenyl)-5-isocyano-4-methylsulfanyl-6-oxopyrimidin-2-yl]benzenesulfonyl chloride is sourced from PubChem (CID 59700947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).