C26H32BrFN4O4 — CID 59700978
1-[4-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]pyrrolidine-2-carboxylic acid (PubChem CID 59700978) has the molecular formula C26H32BrFN4O4 and a molecular weight of 563.47 g/mol. Its IUPAC name is 1-[4-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59700978 |
| Molecular Formula | C26H32BrFN4O4 |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 1-[4-[[amino-[[2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/CCCCN1CCCC1C(=O)O |
| InChI | InChI=1S/C26H32BrFN4O4/c1-36-23-12-10-18(27)16-17(23)9-11-19-20(6-4-7-21(19)28)24(33)31-26(29)30-13-2-3-14-32-15-5-8-22(32)25(34)35/h4,6-7,10,12,16,22H,2-3,5,8-9,11,13-15H2,1H3,(H,34,35)(H3,29,30,31,33) |
| InChIKey | FNZCJSDFSQIDRB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|