About 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole
2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole (PubChem CID 59701340) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole |
| PubChem CID | 59701340 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole |
| SMILES | Cc1nc2c([nH]1)=CCN=2 |
| InChI | InChI=1S/C6H7N3/c1-4-8-5-2-3-7-6(5)9-4/h2H,3H2,1H3,(H,7,8,9) |
| InChIKey | DVADQKQXBDULBL-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole?
The IUPAC name of 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole (CID 59701340) is 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole.
What is the SMILES notation for 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole?
The canonical SMILES for 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole is Cc1nc2c([nH]1)=CCN=2.
What is the InChIKey of 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole?
The InChIKey is DVADQKQXBDULBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-4-8-5-2-3-7-6(5)9-4/h2H,3H2,1H3,(H,7,8,9).
What are the key properties of 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole?
2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole has a molecular weight of 121.14 g/mol, XLogP of -0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,5-dihydropyrrolo[2,3-d]imidazole is sourced from PubChem (CID 59701340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).