C29H29N3O9 — CID 59702192
methyl 3-(1,3-benzodioxol-5-yl)-3-[6-[3-(3-hydroxypropylamino)-2-nitrophenoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoate (PubChem CID 59702192) has the molecular formula C29H29N3O9 and a molecular weight of 563.56 g/mol. Its IUPAC name is methyl 3-(1,3-benzodioxol-5-yl)-3-[6-[3-(3-hydroxypropylamino)-2-nitrophenoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoate.
| Compound Name | methyl 3-(1,3-benzodioxol-5-yl)-3-[6-[3-(3-hydroxypropylamino)-2-nitrophenoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoate |
|---|---|
| PubChem CID | 59702192 |
| Molecular Formula | C29H29N3O9 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | methyl 3-(1,3-benzodioxol-5-yl)-3-[6-[3-(3-hydroxypropylamino)-2-nitrophenoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoate |
| SMILES | COC(=O)CC(c1ccc2c(c1)OCO2)N1CCc2cc(Oc3cccc(NCCCO)c3[N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C29H29N3O9/c1-38-27(34)16-23(19-6-9-24-26(15-19)40-17-39-24)31-12-10-18-14-20(7-8-21(18)29(31)35)41-25-5-2-4-22(28(25)32(36)37)30-11-3-13-33/h2,4-9,14-15,23,30,33H,3,10-13,16-17H2,1H3 |
| InChIKey | QSSJWADCUSBAJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|