About 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate
4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate (PubChem CID 59702428) has the molecular formula C20H36O5Si
and a molecular weight of 384.59 g/mol. Its IUPAC name is 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate.
Molecular Properties
| Compound Name | 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate |
| PubChem CID | 59702428 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCC[Si](OCC)(OCC)OCC)C1C2CCCCC21 |
| InChI | InChI=1S/C20H36O5Si/c1-5-23-26(24-6-2,25-7-3)15-11-10-14-22-20(21)16(4)19-17-12-8-9-13-18(17)19/h17-19H,4-15H2,1-3H3 |
| InChIKey | MBCCVXPGJZAPFE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate?
The IUPAC name of 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate (CID 59702428) is 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate.
What is the SMILES notation for 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate?
The canonical SMILES for 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate is C=C(C(=O)OCCCC[Si](OCC)(OCC)OCC)C1C2CCCCC21.
What is the InChIKey of 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate?
The InChIKey is MBCCVXPGJZAPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O5Si/c1-5-23-26(24-6-2,25-7-3)15-11-10-14-22-20(21)16(4)19-17-12-8-9-13-18(17)19/h17-19H,4-15H2,1-3H3.
What are the key properties of 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate?
4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate has a molecular weight of 384.59 g/mol, XLogP of 4.35, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triethoxysilylbutyl 2-(7-bicyclo[4.1.0]heptanyl)prop-2-enoate is sourced from PubChem (CID 59702428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).