C19H28N8O2S — CID 59702865
2-[6-tert-butyl-7-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)diazenyl]-3-propan-2-ylpyrazolo[5,1-c][1,2,4]triazol-1-yl]acetic acid (PubChem CID 59702865) has the molecular formula C19H28N8O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[6-tert-butyl-7-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)diazenyl]-3-propan-2-ylpyrazolo[5,1-c][1,2,4]triazol-1-yl]acetic acid.
| Compound Name | 2-[6-tert-butyl-7-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)diazenyl]-3-propan-2-ylpyrazolo[5,1-c][1,2,4]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 59702865 |
| Molecular Formula | C19H28N8O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[6-tert-butyl-7-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)diazenyl]-3-propan-2-ylpyrazolo[5,1-c][1,2,4]triazol-1-yl]acetic acid |
| SMILES | CC(C)c1nn(CC(=O)O)c2c(/N=N/c3nnc(C(C)(C)C)s3)c(C(C)(C)C)nn12 |
| InChI | InChI=1S/C19H28N8O2S/c1-10(2)14-25-26(9-11(28)29)15-12(13(18(3,4)5)24-27(14)15)20-22-17-23-21-16(30-17)19(6,7)8/h10H,9H2,1-8H3,(H,28,29)/b22-20+ |
| InChIKey | CTVUYWBJTDGBIV-LSDHQDQOSA-N |
| XLogP | 4.60 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|