C32H32ClN7O2 — CID 59703129
3-[4-[[2-tert-butyl-6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-[2-(4-methoxyphenoxy)ethyl]anilino]propanenitrile (PubChem CID 59703129) has the molecular formula C32H32ClN7O2 and a molecular weight of 582.11 g/mol. Its IUPAC name is 3-[4-[[2-tert-butyl-6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-[2-(4-methoxyphenoxy)ethyl]anilino]propanenitrile.
| Compound Name | 3-[4-[[2-tert-butyl-6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-[2-(4-methoxyphenoxy)ethyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 59703129 |
| Molecular Formula | C32H32ClN7O2 |
| Molecular Weight | 582.11 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 3-[4-[[2-tert-butyl-6-(2-chlorophenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-[2-(4-methoxyphenoxy)ethyl]anilino]propanenitrile |
| SMILES | COc1ccc(OCCN(CCC#N)c2ccc(/N=C3/C(c4ccccc4Cl)=Nn4nc(C(C)(C)C)nc43)cc2)cc1 |
| InChI | InChI=1S/C32H32ClN7O2/c1-32(2,3)31-36-30-29(28(37-40(30)38-31)26-8-5-6-9-27(26)33)35-22-10-12-23(13-11-22)39(19-7-18-34)20-21-42-25-16-14-24(41-4)15-17-25/h5-6,8-17H,7,19-21H2,1-4H3/b35-29- |
| InChIKey | JVURHBVNBCOMKS-MJPNWULPSA-N |
| XLogP | 6.42 |
| TPSA | 100.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.11 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|