C22H25N5O4 — CID 59703384
5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]furan-2-carbaldehyde (PubChem CID 59703384) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]furan-2-carbaldehyde.
| Compound Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 59703384 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]furan-2-carbaldehyde |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(C=O)o3)nc2n1 |
| InChI | InChI=1S/C22H25N5O4/c1-14-12-29-9-7-26(14)21-17-4-5-18(19-6-3-16(11-28)31-19)23-20(17)24-22(25-21)27-8-10-30-13-15(27)2/h3-6,11,14-15H,7-10,12-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | PNZHNLHVPCCJTE-GJZGRUSLSA-N |
| XLogP | 2.55 |
| TPSA | 93.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|