C26H32F2N6O2 — CID 59703524
N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]methyl]-2-fluoroethanamine (PubChem CID 59703524) has the molecular formula C26H32F2N6O2 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]methyl]-2-fluoroethanamine.
| Compound Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]methyl]-2-fluoroethanamine |
|---|---|
| PubChem CID | 59703524 |
| Molecular Formula | C26H32F2N6O2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]methyl]-2-fluoroethanamine |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(F)c(CNCCF)c3)nc2n1 |
| InChI | InChI=1S/C26H32F2N6O2/c1-17-15-35-11-9-33(17)25-21-4-6-23(19-3-5-22(28)20(13-19)14-29-8-7-27)30-24(21)31-26(32-25)34-10-12-36-16-18(34)2/h3-6,13,17-18,29H,7-12,14-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | YQYKPKCJWZHZEE-ROUUACIJSA-N |
| XLogP | 3.34 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|