About 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine
4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 59703801) has the molecular formula C6H6N2S
and a molecular weight of 138.19 g/mol. Its IUPAC name is 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine |
| PubChem CID | 59703801 |
| Molecular Formula | C6H6N2S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | C1=Cc2ncsc2NC1 |
| InChI | InChI=1S/C6H6N2S/c1-2-5-6(7-3-1)9-4-8-5/h1-2,4,7H,3H2 |
| InChIKey | OJQCUGHJQBIUDL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine?
The IUPAC name of 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine (CID 59703801) is 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine.
What is the SMILES notation for 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine?
The canonical SMILES for 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine is C1=Cc2ncsc2NC1.
What is the InChIKey of 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine?
The InChIKey is OJQCUGHJQBIUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2S/c1-2-5-6(7-3-1)9-4-8-5/h1-2,4,7H,3H2.
What are the key properties of 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine?
4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine has a molecular weight of 138.19 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-[1,3]thiazolo[5,4-b]pyridine is sourced from PubChem (CID 59703801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).