C10H18N2O — CID 59704342
1-[(4aS,7aS)-6-methanidyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium-1-yl]ethanone (PubChem CID 59704342) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-[(4aS,7aS)-6-methanidyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium-1-yl]ethanone.
| Compound Name | 1-[(4aS,7aS)-6-methanidyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 59704342 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-[(4aS,7aS)-6-methanidyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium-1-yl]ethanone |
| SMILES | [CH2-][NH+]1C[C@@H]2CCCN(C(C)=O)[C@@H]2C1 |
| InChI | InChI=1S/C10H18N2O/c1-8(13)12-5-3-4-9-6-11(2)7-10(9)12/h9-11H,2-7H2,1H3/t9-,10+/m0/s1 |
| InChIKey | CZXFFXFPJDAYNW-VHSXEESVSA-N |
| XLogP | -0.70 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|