C9H16N2O — CID 59704486
1-(5-methanidyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-5-ium-1-yl)ethanone (PubChem CID 59704486) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(5-methanidyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-5-ium-1-yl)ethanone.
| Compound Name | 1-(5-methanidyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-5-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 59704486 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(5-methanidyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-5-ium-1-yl)ethanone |
| SMILES | [CH2-][NH+]1CC2CCN(C(C)=O)C2C1 |
| InChI | InChI=1S/C9H16N2O/c1-7(12)11-4-3-8-5-10(2)6-9(8)11/h8-10H,2-6H2,1H3 |
| InChIKey | LUNTZAGYMDCFLV-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|