C9H16NO- — CID 59704502
(3aR,4R,7aS)-2-methanidyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 59704502) has the molecular formula C9H16NO- and a molecular weight of 154.23 g/mol. Its IUPAC name is (3aR,4R,7aS)-2-methanidyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | (3aR,4R,7aS)-2-methanidyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 59704502 |
| Molecular Formula | C9H16NO- |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (3aR,4R,7aS)-2-methanidyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | [CH2-]N1C[C@H]2CCC[C@@H](O)[C@H]2C1 |
| InChI | InChI=1S/C9H16NO/c1-10-5-7-3-2-4-9(11)8(7)6-10/h7-9,11H,1-6H2/q-1/t7-,8+,9-/m1/s1 |
| InChIKey | NUOJJOZXLVNRCJ-HRDYMLBCSA-N |
| XLogP | 0.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|