C11H19N2O- — CID 59704533
1-[(3aR,6aS)-2-methanidyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methylpropan-1-one (PubChem CID 59704533) has the molecular formula C11H19N2O- and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-methanidyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(3aR,6aS)-2-methanidyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 59704533 |
| Molecular Formula | C11H19N2O- |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-[(3aR,6aS)-2-methanidyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methylpropan-1-one |
| SMILES | [CH2-]N1C[C@@H]2CN(C(=O)C(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C11H19N2O/c1-8(2)11(14)13-6-9-4-12(3)5-10(9)7-13/h8-10H,3-7H2,1-2H3/q-1/t9-,10+ |
| InChIKey | DSTBJHAVDRIGBL-AOOOYVTPSA-N |
| XLogP | 0.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|