C29H26FN7O5 — CID 59704995
4-[(2,4-dimethoxyphenyl)methylamino]-3-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]benzonitrile (PubChem CID 59704995) has the molecular formula C29H26FN7O5 and a molecular weight of 571.57 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methylamino]-3-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methylamino]-3-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 59704995 |
| Molecular Formula | C29H26FN7O5 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methylamino]-3-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]benzonitrile |
| SMILES | COc1ccc(CNc2ccc(C#N)cc2Nc2ncc([N+](=O)[O-])c(N[C@@H]3CCOc4c(F)cccc43)n2)c(OC)c1 |
| InChI | InChI=1S/C29H26FN7O5/c1-40-19-8-7-18(26(13-19)41-2)15-32-23-9-6-17(14-31)12-24(23)35-29-33-16-25(37(38)39)28(36-29)34-22-10-11-42-27-20(22)4-3-5-21(27)30/h3-9,12-13,16,22,32H,10-11,15H2,1-2H3,(H2,33,34,35,36)/t22-/m1/s1 |
| InChIKey | BXLLEXTXLJYLBY-JOCHJYFZSA-N |
| XLogP | 5.70 |
| TPSA | 156.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|