About 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine
7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine (PubChem CID 59705121) has the molecular formula C17H9ClF3N5S
and a molecular weight of 407.81 g/mol. Its IUPAC name is 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine.
Molecular Properties
| Compound Name | 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine |
| PubChem CID | 59705121 |
| Molecular Formula | C17H9ClF3N5S |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine |
| SMILES | FC(F)(F)c1ccc(Nc2ccnc3nc(-c4ncsc4Cl)ccc23)nc1 |
| InChI | InChI=1S/C17H9ClF3N5S/c18-15-14(24-8-27-15)12-3-2-10-11(5-6-22-16(10)26-12)25-13-4-1-9(7-23-13)17(19,20)21/h1-8H,(H,22,23,25,26) |
| InChIKey | AROHDGMQPCAVJB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine?
The IUPAC name of 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine (CID 59705121) is 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine.
What is the SMILES notation for 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine?
The canonical SMILES for 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine is FC(F)(F)c1ccc(Nc2ccnc3nc(-c4ncsc4Cl)ccc23)nc1.
What is the InChIKey of 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine?
The InChIKey is AROHDGMQPCAVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF3N5S/c18-15-14(24-8-27-15)12-3-2-10-11(5-6-22-16(10)26-12)25-13-4-1-9(7-23-13)17(19,20)21/h1-8H,(H,22,23,25,26).
What are the key properties of 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine?
7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine has a molecular weight of 407.81 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-chloro-1,3-thiazol-4-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]-1,8-naphthyridin-4-amine is sourced from PubChem (CID 59705121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).