C19H24Cl2N6O4 — CID 59705224
tert-butyl N-[3-[[4-[(2,6-dichlorophenyl)methylamino]-5-nitropyrimidin-2-yl]amino]propyl]carbamate (PubChem CID 59705224) has the molecular formula C19H24Cl2N6O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[(2,6-dichlorophenyl)methylamino]-5-nitropyrimidin-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[(2,6-dichlorophenyl)methylamino]-5-nitropyrimidin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 59705224 |
| Molecular Formula | C19H24Cl2N6O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | tert-butyl N-[3-[[4-[(2,6-dichlorophenyl)methylamino]-5-nitropyrimidin-2-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ncc([N+](=O)[O-])c(NCc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C19H24Cl2N6O4/c1-19(2,3)31-18(28)23-9-5-8-22-17-25-11-15(27(29)30)16(26-17)24-10-12-13(20)6-4-7-14(12)21/h4,6-7,11H,5,8-10H2,1-3H3,(H,23,28)(H2,22,24,25,26) |
| InChIKey | MQDBPGPCLVZZQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|