About 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one
9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one (PubChem CID 59705256) has the molecular formula C17H18Cl2N6O
and a molecular weight of 393.28 g/mol. Its IUPAC name is 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one.
Molecular Properties
| Compound Name | 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
| PubChem CID | 59705256 |
| Molecular Formula | C17H18Cl2N6O |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(NC[C@H]3CCNC3)nc2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H18Cl2N6O/c18-12-2-1-3-13(19)11(12)9-25-15-14(23-17(25)26)8-22-16(24-15)21-7-10-4-5-20-6-10/h1-3,8,10,20H,4-7,9H2,(H,23,26)(H,21,22,24)/t10-/m0/s1 |
| InChIKey | UPLJSZLVRWGWKH-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one?
The IUPAC name of 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one (CID 59705256) is 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one.
What is the SMILES notation for 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one?
The canonical SMILES for 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one is O=c1[nH]c2cnc(NC[C@H]3CCNC3)nc2n1Cc1c(Cl)cccc1Cl.
What is the InChIKey of 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one?
The InChIKey is UPLJSZLVRWGWKH-JTQLQIEISA-N. The full InChI is InChI=1S/C17H18Cl2N6O/c18-12-2-1-3-13(19)11(12)9-25-15-14(23-17(25)26)8-22-16(24-15)21-7-10-4-5-20-6-10/h1-3,8,10,20H,4-7,9H2,(H,23,26)(H,21,22,24)/t10-/m0/s1.
What are the key properties of 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one?
9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one has a molecular weight of 393.28 g/mol, XLogP of 2.50, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-dichlorophenyl)methyl]-2-[[(3S)-pyrrolidin-3-yl]methylamino]-7H-purin-8-one is sourced from PubChem (CID 59705256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).