C20H19NO5 — CID 59705377
3-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propyl 4-ethenylbenzoate (PubChem CID 59705377) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propyl 4-ethenylbenzoate.
| Compound Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propyl 4-ethenylbenzoate |
|---|---|
| PubChem CID | 59705377 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)propyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCCCN2C(=O)C3C4C=CC(O4)C3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-2-12-4-6-13(7-5-12)20(24)25-11-3-10-21-18(22)16-14-8-9-15(26-14)17(16)19(21)23/h2,4-9,14-17H,1,3,10-11H2 |
| InChIKey | ASVSODFROAWEJI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|