About CID 59705712
CID 59705712 (PubChem CID 59705712) has the molecular formula C11H12NO3S
and a molecular weight of 238.29 g/mol.
Molecular Properties
| Compound Name | CID 59705712 |
| PubChem CID | 59705712 |
| Molecular Formula | C11H12NO3S |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | — |
| SMILES | NC(=O)[CH]CSC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H12NO3S/c12-9(13)6-7-16-10(11(14)15)8-4-2-1-3-5-8/h1-6,10H,7H2,(H2,12,13)(H,14,15) |
| InChIKey | IRWDQUISGBWQJI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59705712 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59705712?
The IUPAC name of CID 59705712 (CID 59705712) is not available.
What is the SMILES notation for CID 59705712?
The canonical SMILES for CID 59705712 is NC(=O)[CH]CSC(C(=O)O)c1ccccc1.
What is the InChIKey of CID 59705712?
The InChIKey is IRWDQUISGBWQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO3S/c12-9(13)6-7-16-10(11(14)15)8-4-2-1-3-5-8/h1-6,10H,7H2,(H2,12,13)(H,14,15).
What are the key properties of CID 59705712?
CID 59705712 has a molecular weight of 238.29 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59705712 is sourced from PubChem (CID 59705712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).