About [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate
[1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate (PubChem CID 59705884) has the molecular formula C13H18F6O3
and a molecular weight of 336.27 g/mol. Its IUPAC name is [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate.
Molecular Properties
| Compound Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate |
| PubChem CID | 59705884 |
| Molecular Formula | C13H18F6O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate |
| SMILES | CCC(=O)OC(C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O3/c1-2-9(20)22-10(8-6-4-3-5-7-8)11(21,12(14,15)16)13(17,18)19/h8,10,21H,2-7H2,1H3 |
| InChIKey | AJHHXIWXULUONV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate?
The IUPAC name of [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate (CID 59705884) is [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate.
What is the SMILES notation for [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate?
The canonical SMILES for [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate is CCC(=O)OC(C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate?
The InChIKey is AJHHXIWXULUONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F6O3/c1-2-9(20)22-10(8-6-4-3-5-7-8)11(21,12(14,15)16)13(17,18)19/h8,10,21H,2-7H2,1H3.
What are the key properties of [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate?
[1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate has a molecular weight of 336.27 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] propanoate is sourced from PubChem (CID 59705884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).