C7H11F3O2 — CID 59705891
(4S)-4-methyl-2-(trifluoromethyl)oxan-2-ol (PubChem CID 59705891) has the molecular formula C7H11F3O2 and a molecular weight of 184.16 g/mol. Its IUPAC name is (4S)-4-methyl-2-(trifluoromethyl)oxan-2-ol.
| Compound Name | (4S)-4-methyl-2-(trifluoromethyl)oxan-2-ol |
|---|---|
| PubChem CID | 59705891 |
| Molecular Formula | C7H11F3O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (4S)-4-methyl-2-(trifluoromethyl)oxan-2-ol |
| SMILES | C[C@H]1CCOC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3O2/c1-5-2-3-12-6(11,4-5)7(8,9)10/h5,11H,2-4H2,1H3/t5-,6?/m0/s1 |
| InChIKey | ZLFPZPTWFWGXAY-ZBHICJROSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |