About N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine
N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine (PubChem CID 597059) has the molecular formula C34H24N2
and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine.
Molecular Properties
| Compound Name | N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine |
| PubChem CID | 597059 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine |
| SMILES | C(=Nc1ccc(N=C=C(c2ccccc2)c2ccccc2)cc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H24N2/c1-5-13-27(14-6-1)33(28-15-7-2-8-16-28)25-35-31-21-23-32(24-22-31)36-26-34(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-24H |
| InChIKey | UTKMOLGWWXFTSS-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine?
The IUPAC name of N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine (CID 597059) is N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine.
What is the SMILES notation for N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine?
The canonical SMILES for N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine is C(=Nc1ccc(N=C=C(c2ccccc2)c2ccccc2)cc1)=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine?
The InChIKey is UTKMOLGWWXFTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H24N2/c1-5-13-27(14-6-1)33(28-15-7-2-8-16-28)25-35-31-21-23-32(24-22-31)36-26-34(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-24H.
What are the key properties of N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine?
N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine has a molecular weight of 460.58 g/mol, XLogP of 8.55, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,2-diphenylethenylideneamino)phenyl]-2,2-diphenylethenimine is sourced from PubChem (CID 597059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).